C14H14Cl2FNO3 — CID 171370185
ethyl 3-(2,4-dichloro-5-fluorophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate (PubChem CID 171370185) has the molecular formula C14H14Cl2FNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is ethyl 3-(2,4-dichloro-5-fluorophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(2,4-dichloro-5-fluorophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 171370185 |
| Molecular Formula | C14H14Cl2FNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | ethyl 3-(2,4-dichloro-5-fluorophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate |
| SMILES | CC/N=C/C(C(=O)OCC)=C(O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2FNO3/c1-3-18-7-9(14(20)21-4-2)13(19)8-5-12(17)11(16)6-10(8)15/h5-7,19H,3-4H2,1-2H3/b13-9?,18-7+ |
| InChIKey | FFBMETIQMRQWCR-PXVLCNHJSA-N |
| XLogP | 4.06 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|