C15H12ClF4NO3 — CID 135773541
ethyl (E)-3-(3-chloro-2,4,5-trifluorophenyl)-2-[[(1S,2S)-2-fluorocyclopropyl]iminomethyl]-3-hydroxyprop-2-enoate (PubChem CID 135773541) has the molecular formula C15H12ClF4NO3 and a molecular weight of 365.71 g/mol. Its IUPAC name is ethyl (E)-3-(3-chloro-2,4,5-trifluorophenyl)-2-[[(1S,2S)-2-fluorocyclopropyl]iminomethyl]-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (E)-3-(3-chloro-2,4,5-trifluorophenyl)-2-[[(1S,2S)-2-fluorocyclopropyl]iminomethyl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135773541 |
| Molecular Formula | C15H12ClF4NO3 |
| Molecular Weight | 365.71 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | ethyl (E)-3-(3-chloro-2,4,5-trifluorophenyl)-2-[[(1S,2S)-2-fluorocyclopropyl]iminomethyl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/[C@H]1C[C@@H]1F)=C(/O)c1cc(F)c(F)c(Cl)c1F |
| InChI | InChI=1S/C15H12ClF4NO3/c1-2-24-15(23)7(5-21-10-4-8(10)17)14(22)6-3-9(18)13(20)11(16)12(6)19/h3,5,8,10,22H,2,4H2,1H3/b14-7+,21-5+/t8-,10-/m0/s1 |
| InChIKey | DLZXQGXVLKEXRH-SXDLIHCGSA-N |
| XLogP | 3.77 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|