C18H19F4NO4 — CID 135987226
ethyl (Z)-3-hydroxy-2-[[1-(hydroxymethyl)cyclobutyl]methyliminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate (PubChem CID 135987226) has the molecular formula C18H19F4NO4 and a molecular weight of 389.35 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-2-[[1-(hydroxymethyl)cyclobutyl]methyliminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-hydroxy-2-[[1-(hydroxymethyl)cyclobutyl]methyliminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135987226 |
| Molecular Formula | C18H19F4NO4 |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | ethyl (Z)-3-hydroxy-2-[[1-(hydroxymethyl)cyclobutyl]methyliminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/CC1(CO)CCC1)=C(\O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H19F4NO4/c1-2-27-17(26)11(7-23-8-18(9-24)4-3-5-18)16(25)10-6-12(19)14(21)15(22)13(10)20/h6-7,24-25H,2-5,8-9H2,1H3/b16-11-,23-7+ |
| InChIKey | DYSOXVRGIQPELG-RHLTYJKDSA-N |
| XLogP | 3.31 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|