C19H24F3N3O3S — CID 135490920
ethyl (Z)-3-hydroxy-2-(2-sulfanylethyliminomethyl)-3-[2,3,5-trifluoro-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enoate (PubChem CID 135490920) has the molecular formula C19H24F3N3O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-2-(2-sulfanylethyliminomethyl)-3-[2,3,5-trifluoro-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-hydroxy-2-(2-sulfanylethyliminomethyl)-3-[2,3,5-trifluoro-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 135490920 |
| Molecular Formula | C19H24F3N3O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl (Z)-3-hydroxy-2-(2-sulfanylethyliminomethyl)-3-[2,3,5-trifluoro-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/CCS)=C(\O)c1cc(F)c(N2CCN(C)CC2)c(F)c1F |
| InChI | InChI=1S/C19H24F3N3O3S/c1-3-28-19(27)13(11-23-4-9-29)18(26)12-10-14(20)17(16(22)15(12)21)25-7-5-24(2)6-8-25/h10-11,26,29H,3-9H2,1-2H3/b18-13-,23-11+ |
| InChIKey | BHVAHPGWNREFJQ-RCUKCGFVSA-N |
| XLogP | 2.69 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|