C17H18F4N2O3 — CID 15300720
ethyl (Z)-3-(4-methylpiperazin-1-yl)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enoate (PubChem CID 15300720) has the molecular formula C17H18F4N2O3 and a molecular weight of 374.33 g/mol. Its IUPAC name is ethyl (Z)-3-(4-methylpiperazin-1-yl)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-(4-methylpiperazin-1-yl)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enoate |
|---|---|
| PubChem CID | 15300720 |
| Molecular Formula | C17H18F4N2O3 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl (Z)-3-(4-methylpiperazin-1-yl)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\N1CCN(C)CC1)C(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H18F4N2O3/c1-3-26-17(25)11(9-23-6-4-22(2)5-7-23)16(24)10-8-12(18)14(20)15(21)13(10)19/h8-9H,3-7H2,1-2H3/b11-9- |
| InChIKey | XISGJKXMIRZBNY-LUAWRHEFSA-N |
| XLogP | 2.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|