C16H18FNO3 — CID 5367039
ethyl (2Z,4Z)-2-benzoyl-5-(dimethylamino)-4-fluoropenta-2,4-dienoate (PubChem CID 5367039) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is ethyl (2Z,4Z)-2-benzoyl-5-(dimethylamino)-4-fluoropenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4Z)-2-benzoyl-5-(dimethylamino)-4-fluoropenta-2,4-dienoate |
|---|---|
| PubChem CID | 5367039 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | ethyl (2Z,4Z)-2-benzoyl-5-(dimethylamino)-4-fluoropenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C\C(F)=C\N(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18FNO3/c1-4-21-16(20)14(10-13(17)11-18(2)3)15(19)12-8-6-5-7-9-12/h5-11H,4H2,1-3H3/b13-11-,14-10- |
| InChIKey | FHUJHBQVUVPCNM-QFCYPFEVSA-N |
| XLogP | 2.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|