C15H13BrF3NO3 — CID 135406438
ethyl (Z)-3-(3-bromo-2,4,5-trifluorophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate (PubChem CID 135406438) has the molecular formula C15H13BrF3NO3 and a molecular weight of 392.17 g/mol. Its IUPAC name is ethyl (Z)-3-(3-bromo-2,4,5-trifluorophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-3-(3-bromo-2,4,5-trifluorophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135406438 |
| Molecular Formula | C15H13BrF3NO3 |
| Molecular Weight | 392.17 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | ethyl (Z)-3-(3-bromo-2,4,5-trifluorophenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1)=C(\O)c1cc(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C15H13BrF3NO3/c1-2-23-15(22)9(6-20-7-3-4-7)14(21)8-5-10(17)13(19)11(16)12(8)18/h5-7,21H,2-4H2,1H3/b14-9-,20-6+ |
| InChIKey | GCSCURAWKACUAQ-IYDXNWEYSA-N |
| XLogP | 3.93 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.17 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|