C16H17BrFNO3 — CID 157375204
ethyl 3-(4-bromo-2-fluoro-5-methylphenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate (PubChem CID 157375204) has the molecular formula C16H17BrFNO3 and a molecular weight of 370.22 g/mol. Its IUPAC name is ethyl 3-(4-bromo-2-fluoro-5-methylphenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(4-bromo-2-fluoro-5-methylphenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 157375204 |
| Molecular Formula | C16H17BrFNO3 |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | ethyl 3-(4-bromo-2-fluoro-5-methylphenyl)-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1)=C(O)c1cc(C)c(Br)cc1F |
| InChI | InChI=1S/C16H17BrFNO3/c1-3-22-16(21)12(8-19-10-4-5-10)15(20)11-6-9(2)13(17)7-14(11)18/h6-8,10,20H,3-5H2,1-2H3/b15-12?,19-8+ |
| InChIKey | AKZXOQROZIJUDV-JYYWPLCWSA-N |
| XLogP | 3.96 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|