C16H17F4NO3 — CID 173338893
ethyl 2-(cyclopropyliminomethyl)-3-hydroxy-3-(3,4,5,6-tetrafluoro-3-methylcyclohexa-1,4-dien-1-yl)prop-2-enoate (PubChem CID 173338893) has the molecular formula C16H17F4NO3 and a molecular weight of 347.31 g/mol. Its IUPAC name is ethyl 2-(cyclopropyliminomethyl)-3-hydroxy-3-(3,4,5,6-tetrafluoro-3-methylcyclohexa-1,4-dien-1-yl)prop-2-enoate.
| Compound Name | ethyl 2-(cyclopropyliminomethyl)-3-hydroxy-3-(3,4,5,6-tetrafluoro-3-methylcyclohexa-1,4-dien-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 173338893 |
| Molecular Formula | C16H17F4NO3 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | ethyl 2-(cyclopropyliminomethyl)-3-hydroxy-3-(3,4,5,6-tetrafluoro-3-methylcyclohexa-1,4-dien-1-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1)=C(O)C1=CC(C)(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C16H17F4NO3/c1-3-24-15(23)10(7-21-8-4-5-8)13(22)9-6-16(2,20)14(19)12(18)11(9)17/h6-8,11,22H,3-5H2,1-2H3/b13-10?,21-7+ |
| InChIKey | AGOSOJGFXYFIFF-GQPKMNDTSA-N |
| XLogP | 3.75 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|