C16H16F5NO3 — CID 173330694
ethyl 2-(cyclopropyliminomethyl)-3-[2,4-difluoro-4-(trifluoromethyl)cyclohexa-2,5-dien-1-yl]-3-hydroxyprop-2-enoate (PubChem CID 173330694) has the molecular formula C16H16F5NO3 and a molecular weight of 365.30 g/mol. Its IUPAC name is ethyl 2-(cyclopropyliminomethyl)-3-[2,4-difluoro-4-(trifluoromethyl)cyclohexa-2,5-dien-1-yl]-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 2-(cyclopropyliminomethyl)-3-[2,4-difluoro-4-(trifluoromethyl)cyclohexa-2,5-dien-1-yl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 173330694 |
| Molecular Formula | C16H16F5NO3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | ethyl 2-(cyclopropyliminomethyl)-3-[2,4-difluoro-4-(trifluoromethyl)cyclohexa-2,5-dien-1-yl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1)=C(O)C1C=CC(F)(C(F)(F)F)C=C1F |
| InChI | InChI=1S/C16H16F5NO3/c1-2-25-14(24)11(8-22-9-3-4-9)13(23)10-5-6-15(18,7-12(10)17)16(19,20)21/h5-10,23H,2-4H2,1H3/b13-11?,22-8+ |
| InChIKey | DWLIHBQZORWDMV-HQGYCITISA-N |
| XLogP | 3.90 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|