C16H14F7NO4 — CID 137211307
ethyl (E)-4,4,5,5,6,6,6-heptafluoro-3-hydroxy-2-[(4-methoxyphenyl)iminomethyl]hex-2-enoate (PubChem CID 137211307) has the molecular formula C16H14F7NO4 and a molecular weight of 417.28 g/mol. Its IUPAC name is ethyl (E)-4,4,5,5,6,6,6-heptafluoro-3-hydroxy-2-[(4-methoxyphenyl)iminomethyl]hex-2-enoate.
| Compound Name | ethyl (E)-4,4,5,5,6,6,6-heptafluoro-3-hydroxy-2-[(4-methoxyphenyl)iminomethyl]hex-2-enoate |
|---|---|
| PubChem CID | 137211307 |
| Molecular Formula | C16H14F7NO4 |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | ethyl (E)-4,4,5,5,6,6,6-heptafluoro-3-hydroxy-2-[(4-methoxyphenyl)iminomethyl]hex-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(OC)cc1)=C(/O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F7NO4/c1-3-28-13(26)11(8-24-9-4-6-10(27-2)7-5-9)12(25)14(17,18)15(19,20)16(21,22)23/h4-8,25H,3H2,1-2H3/b12-11+,24-8+ |
| InChIKey | VYBRILYCMKMADQ-BVRXPHCDSA-N |
| XLogP | 4.61 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|