C12H14N2O3 — CID 147710768
3-amino-2-[(4-methoxyphenyl)iminomethyl]but-2-enoic acid (PubChem CID 147710768) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-amino-2-[(4-methoxyphenyl)iminomethyl]but-2-enoic acid.
| Compound Name | 3-amino-2-[(4-methoxyphenyl)iminomethyl]but-2-enoic acid |
|---|---|
| PubChem CID | 147710768 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-amino-2-[(4-methoxyphenyl)iminomethyl]but-2-enoic acid |
| SMILES | COc1ccc(/N=C/C(C(=O)O)=C(C)N)cc1 |
| InChI | InChI=1S/C12H14N2O3/c1-8(13)11(12(15)16)7-14-9-3-5-10(17-2)6-4-9/h3-7H,13H2,1-2H3,(H,15,16)/b11-8?,14-7+ |
| InChIKey | TVEKRNRQCWZLCS-KVFKRCGNSA-N |
| XLogP | 1.71 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|