C18H14F13NO3 — CID 12654231
ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-(4-methoxyphenyl)iminononanoate (PubChem CID 12654231) has the molecular formula C18H14F13NO3 and a molecular weight of 539.29 g/mol. Its IUPAC name is ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-(4-methoxyphenyl)iminononanoate.
| Compound Name | ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-(4-methoxyphenyl)iminononanoate |
|---|---|
| PubChem CID | 12654231 |
| Molecular Formula | C18H14F13NO3 |
| Molecular Weight | 539.29 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-(4-methoxyphenyl)iminononanoate |
| SMILES | CCOC(=O)C/C(=N\c1ccc(OC)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H14F13NO3/c1-3-35-12(33)8-11(32-9-4-6-10(34-2)7-5-9)13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h4-7H,3,8H2,1-2H3/b32-11+ |
| InChIKey | BIPAXMBYGKBWKY-MPRHAZATSA-N |
| XLogP | 6.46 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.29 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|