C23H16F15NO2S — CID 10995905
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-N-(4-methoxyphenyl)-1-[(R)-(4-methylphenyl)sulfinyl]nonan-2-imine (PubChem CID 10995905) has the molecular formula C23H16F15NO2S and a molecular weight of 655.42 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-N-(4-methoxyphenyl)-1-[(R)-(4-methylphenyl)sulfinyl]nonan-2-imine.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-N-(4-methoxyphenyl)-1-[(R)-(4-methylphenyl)sulfinyl]nonan-2-imine |
|---|---|
| PubChem CID | 10995905 |
| Molecular Formula | C23H16F15NO2S |
| Molecular Weight | 655.42 g/mol |
| Exact Mass | 655.07 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-N-(4-methoxyphenyl)-1-[(R)-(4-methylphenyl)sulfinyl]nonan-2-imine |
| SMILES | COc1ccc(/N=C(\C[S@@](=O)c2ccc(C)cc2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16F15NO2S/c1-12-3-9-15(10-4-12)42(40)11-16(39-13-5-7-14(41-2)8-6-13)17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)38/h3-10H,11H2,1-2H3/b39-16+/t42-/m1/s1 |
| InChIKey | UKKBUSURHHNHTH-HZPRSMCXSA-N |
| XLogP | 8.26 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.42 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|