C10H10F3NO — CID 14116536
1,1,1-trifluoro-N-(4-methoxyphenyl)propan-2-imine (PubChem CID 14116536) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(4-methoxyphenyl)propan-2-imine.
| Compound Name | 1,1,1-trifluoro-N-(4-methoxyphenyl)propan-2-imine |
|---|---|
| PubChem CID | 14116536 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1,1,1-trifluoro-N-(4-methoxyphenyl)propan-2-imine |
| SMILES | COc1ccc(/N=C(\C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO/c1-7(10(11,12)13)14-8-3-5-9(15-2)6-4-8/h3-6H,1-2H3/b14-7+ |
| InChIKey | JWYVMWMPDGALGS-VGOFMYFVSA-N |
| XLogP | 3.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|