C15H11F3N2O3 — CID 177478664
2,2,2-trifluoro-1-(4-methoxyphenyl)-N-(4-nitrophenyl)ethanimine (PubChem CID 177478664) has the molecular formula C15H11F3N2O3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-methoxyphenyl)-N-(4-nitrophenyl)ethanimine.
| Compound Name | 2,2,2-trifluoro-1-(4-methoxyphenyl)-N-(4-nitrophenyl)ethanimine |
|---|---|
| PubChem CID | 177478664 |
| Molecular Formula | C15H11F3N2O3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-methoxyphenyl)-N-(4-nitrophenyl)ethanimine |
| SMILES | COc1ccc(/C(=N/c2ccc([N+](=O)[O-])cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11F3N2O3/c1-23-13-8-2-10(3-9-13)14(15(16,17)18)19-11-4-6-12(7-5-11)20(21)22/h2-9H,1H3/b19-14- |
| InChIKey | SETAMOGUXKDOBF-RGEXLXHISA-N |
| XLogP | 4.29 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|