C12H11F3KNO3 — CID 102402408
potassium (2S)-2-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]propanoate (PubChem CID 102402408) has the molecular formula C12H11F3KNO3 and a molecular weight of 313.32 g/mol. Its IUPAC name is potassium (2S)-2-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]propanoate.
| Compound Name | potassium (2S)-2-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]propanoate |
|---|---|
| PubChem CID | 102402408 |
| Molecular Formula | C12H11F3KNO3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | potassium (2S)-2-[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]propanoate |
| SMILES | COc1ccc(/C(=N\[C@@H](C)C(=O)[O-])C(F)(F)F)cc1.[K+] |
| InChI | InChI=1S/C12H12F3NO3.K/c1-7(11(17)18)16-10(12(13,14)15)8-3-5-9(19-2)6-4-8;/h3-7H,1-2H3,(H,17,18);/q;+1/p-1/b16-10+;/t7-;/m0./s1 |
| InChIKey | CJZHNNLQKCGMSJ-UXIJIIJVSA-M |
| XLogP | -1.81 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|