C12H10F6N2O2 — CID 59115160
2,2,2-trifluoro-N-methoxy-1-[4-[N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenyl]ethanimine (PubChem CID 59115160) has the molecular formula C12H10F6N2O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methoxy-1-[4-[N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenyl]ethanimine.
| Compound Name | 2,2,2-trifluoro-N-methoxy-1-[4-[N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenyl]ethanimine |
|---|---|
| PubChem CID | 59115160 |
| Molecular Formula | C12H10F6N2O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2,2,2-trifluoro-N-methoxy-1-[4-[N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenyl]ethanimine |
| SMILES | CON=C(c1ccc(C(=NOC)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H10F6N2O2/c1-21-19-9(11(13,14)15)7-3-5-8(6-4-7)10(20-22-2)12(16,17)18/h3-6H,1-2H3 |
| InChIKey | JYAJJBQYGAJODZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|