C21H20F6N2O4S2 — CID 58241618
(Z)-2,2,2-trifluoro-N-methylsulfanyloxy-1-[4-[3-[4-[(Z)-N-methylsulfanyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethanimine (PubChem CID 58241618) has the molecular formula C21H20F6N2O4S2 and a molecular weight of 542.52 g/mol. Its IUPAC name is (Z)-2,2,2-trifluoro-N-methylsulfanyloxy-1-[4-[3-[4-[(Z)-N-methylsulfanyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethanimine.
| Compound Name | (Z)-2,2,2-trifluoro-N-methylsulfanyloxy-1-[4-[3-[4-[(Z)-N-methylsulfanyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethanimine |
|---|---|
| PubChem CID | 58241618 |
| Molecular Formula | C21H20F6N2O4S2 |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | (Z)-2,2,2-trifluoro-N-methylsulfanyloxy-1-[4-[3-[4-[(Z)-N-methylsulfanyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethanimine |
| SMILES | CSO/N=C(/c1ccc(OCCCOc2ccc(/C(=N/OSC)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H20F6N2O4S2/c1-34-32-28-18(20(22,23)24)14-4-8-16(9-5-14)30-12-3-13-31-17-10-6-15(7-11-17)19(21(25,26)27)29-33-35-2/h4-11H,3,12-13H2,1-2H3/b28-18-,29-19- |
| InChIKey | XRKAGTXTUGXOOH-IFEPHKIBSA-N |
| XLogP | 6.66 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|