C24H26F6N2O8S2 — CID 76835630
[[1-[4-[3-[4-[N-ethylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate (PubChem CID 76835630) has the molecular formula C24H26F6N2O8S2 and a molecular weight of 648.60 g/mol. Its IUPAC name is [[1-[4-[3-[4-[N-ethylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate.
| Compound Name | [[1-[4-[3-[4-[N-ethylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate |
|---|---|
| PubChem CID | 76835630 |
| Molecular Formula | C24H26F6N2O8S2 |
| Molecular Weight | 648.60 g/mol |
| Exact Mass | 648.10 |
| IUPAC Name | [[1-[4-[3-[4-[N-ethylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]-2,2,2-trifluoroethylidene]amino] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)ON=C(c1ccc(OCCCOc2ccc(C(=NOS(=O)(=O)CC)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H26F6N2O8S2/c1-3-16-42(35,36)40-32-22(24(28,29)30)18-8-12-20(13-9-18)38-15-5-14-37-19-10-6-17(7-11-19)21(23(25,26)27)31-39-41(33,34)4-2/h6-13H,3-5,14-16H2,1-2H3 |
| InChIKey | ORNVKWRNISEPMB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|