C14H20F3N2O4S+ — CID 23591355
trimethyl-[2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl]azanium (PubChem CID 23591355) has the molecular formula C14H20F3N2O4S+ and a molecular weight of 369.39 g/mol. Its IUPAC name is trimethyl-[2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl]azanium |
|---|---|
| PubChem CID | 23591355 |
| Molecular Formula | C14H20F3N2O4S+ |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | trimethyl-[2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl]azanium |
| SMILES | C[N+](C)(C)CCOc1ccc(/C(=N/OS(C)(=O)=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20F3N2O4S/c1-19(2,3)9-10-22-12-7-5-11(6-8-12)13(14(15,16)17)18-23-24(4,20)21/h5-8H,9-10H2,1-4H3/q+1/b18-13- |
| InChIKey | JYWHIWFAROUUFG-AQTBWJFISA-N |
| XLogP | 2.01 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|