C19H16F6N2O4 — CID 74062449
N-[2,2,2-trifluoro-1-[4-[3-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]hydroxylamine (PubChem CID 74062449) has the molecular formula C19H16F6N2O4 and a molecular weight of 450.34 g/mol. Its IUPAC name is N-[2,2,2-trifluoro-1-[4-[3-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]hydroxylamine.
| Compound Name | N-[2,2,2-trifluoro-1-[4-[3-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 74062449 |
| Molecular Formula | C19H16F6N2O4 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-[2,2,2-trifluoro-1-[4-[3-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]hydroxylamine |
| SMILES | ON=C(c1ccc(OCCCOc2ccc(C(=NO)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H16F6N2O4/c20-18(21,22)16(26-28)12-2-6-14(7-3-12)30-10-1-11-31-15-8-4-13(5-9-15)17(27-29)19(23,24)25/h2-9,28-29H,1,10-11H2 |
| InChIKey | SYXZKGJVDFBIOH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|