C11H12F3NO — CID 21020679
1-(4-ethoxyphenyl)-2,2,2-trifluoro-N-methylethanimine (PubChem CID 21020679) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,2,2-trifluoro-N-methylethanimine.
| Compound Name | 1-(4-ethoxyphenyl)-2,2,2-trifluoro-N-methylethanimine |
|---|---|
| PubChem CID | 21020679 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,2,2-trifluoro-N-methylethanimine |
| SMILES | CCOc1ccc(/C(=N\C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO/c1-3-16-9-6-4-8(5-7-9)10(15-2)11(12,13)14/h4-7H,3H2,1-2H3/b15-10+ |
| InChIKey | MLWIEQPAGOLWHC-XNTDXEJSSA-N |
| XLogP | 3.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|