C14H18F3NO4S — CID 58836333
[(Z)-[2,2,2-trifluoro-1-(4-propoxyphenyl)ethylidene]amino] propane-1-sulfonate (PubChem CID 58836333) has the molecular formula C14H18F3NO4S and a molecular weight of 353.36 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-(4-propoxyphenyl)ethylidene]amino] propane-1-sulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-(4-propoxyphenyl)ethylidene]amino] propane-1-sulfonate |
|---|---|
| PubChem CID | 58836333 |
| Molecular Formula | C14H18F3NO4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-(4-propoxyphenyl)ethylidene]amino] propane-1-sulfonate |
| SMILES | CCCOc1ccc(/C(=N/OS(=O)(=O)CCC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NO4S/c1-3-9-21-12-7-5-11(6-8-12)13(14(15,16)17)18-22-23(19,20)10-4-2/h5-8H,3-4,9-10H2,1-2H3/b18-13- |
| InChIKey | CTIHSYIPWPFBGJ-AQTBWJFISA-N |
| XLogP | 3.50 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|