C19H27F3N2O8S2 — CID 172961828
3-[4-[(E)-C-methyl-N-propylsulfonyloxycarbonimidoyl]phenoxy]propyl (1E)-2,2,2-trifluoro-N-propylsulfonyloxyethanimidate (PubChem CID 172961828) has the molecular formula C19H27F3N2O8S2 and a molecular weight of 532.56 g/mol. Its IUPAC name is 3-[4-[(E)-C-methyl-N-propylsulfonyloxycarbonimidoyl]phenoxy]propyl (1E)-2,2,2-trifluoro-N-propylsulfonyloxyethanimidate.
| Compound Name | 3-[4-[(E)-C-methyl-N-propylsulfonyloxycarbonimidoyl]phenoxy]propyl (1E)-2,2,2-trifluoro-N-propylsulfonyloxyethanimidate |
|---|---|
| PubChem CID | 172961828 |
| Molecular Formula | C19H27F3N2O8S2 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 3-[4-[(E)-C-methyl-N-propylsulfonyloxycarbonimidoyl]phenoxy]propyl (1E)-2,2,2-trifluoro-N-propylsulfonyloxyethanimidate |
| SMILES | CCCS(=O)(=O)O/N=C(\C)c1ccc(OCCCO/C(=N/OS(=O)(=O)CCC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H27F3N2O8S2/c1-4-13-33(25,26)31-23-15(3)16-7-9-17(10-8-16)29-11-6-12-30-18(19(20,21)22)24-32-34(27,28)14-5-2/h7-10H,4-6,11-14H2,1-3H3/b23-15+,24-18+ |
| InChIKey | IRCFANSANMTHIC-IJTFWQNGSA-N |
| XLogP | 3.58 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|