C23H24F6N2O5S — CID 88904998
[(Z)-[2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethanimidoyl)phenoxy]propoxy]phenyl]ethylidene]amino] butane-1-sulfonate (PubChem CID 88904998) has the molecular formula C23H24F6N2O5S and a molecular weight of 554.51 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethanimidoyl)phenoxy]propoxy]phenyl]ethylidene]amino] butane-1-sulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethanimidoyl)phenoxy]propoxy]phenyl]ethylidene]amino] butane-1-sulfonate |
|---|---|
| PubChem CID | 88904998 |
| Molecular Formula | C23H24F6N2O5S |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethanimidoyl)phenoxy]propoxy]phenyl]ethylidene]amino] butane-1-sulfonate |
| SMILES | [H]/N=C(\c1ccc(OCCCOc2ccc(/C(=N/OS(=O)(=O)CCCC)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H24F6N2O5S/c1-2-3-15-37(32,33)36-31-21(23(27,28)29)17-7-11-19(12-8-17)35-14-4-13-34-18-9-5-16(6-10-18)20(30)22(24,25)26/h5-12,30H,2-4,13-15H2,1H3/b30-20+,31-21- |
| InChIKey | LDPNZZAIEWLLTM-FEGSLFPESA-N |
| XLogP | 5.88 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|