C19H18F6N2O2 — CID 134525764
2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethanimidoyl)phenoxy]propoxy]phenyl]ethanamine (PubChem CID 134525764) has the molecular formula C19H18F6N2O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethanimidoyl)phenoxy]propoxy]phenyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethanimidoyl)phenoxy]propoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 134525764 |
| Molecular Formula | C19H18F6N2O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethanimidoyl)phenoxy]propoxy]phenyl]ethanamine |
| SMILES | [H]/N=C(\c1ccc(OCCCOc2ccc(C(N)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H18F6N2O2/c20-18(21,22)16(26)12-2-6-14(7-3-12)28-10-1-11-29-15-8-4-13(5-9-15)17(27)19(23,24)25/h2-9,16,27H,1,10-11,26H2/b27-17+ |
| InChIKey | FWKIMVYYMXKDQC-WPWMEQJKSA-N |
| XLogP | 5.03 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|