C21H14F12N2O8S2 — CID 143602719
[[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-C-(trifluoromethyl)-N-(trifluoromethylsulfonyloxy)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] trifluoromethanesulfonate (PubChem CID 143602719) has the molecular formula C21H14F12N2O8S2 and a molecular weight of 714.46 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-C-(trifluoromethyl)-N-(trifluoromethylsulfonyloxy)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] trifluoromethanesulfonate.
| Compound Name | [[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-C-(trifluoromethyl)-N-(trifluoromethylsulfonyloxy)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143602719 |
| Molecular Formula | C21H14F12N2O8S2 |
| Molecular Weight | 714.46 g/mol |
| Exact Mass | 714.00 |
| IUPAC Name | [[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-C-(trifluoromethyl)-N-(trifluoromethylsulfonyloxy)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] trifluoromethanesulfonate |
| SMILES | O=S(=O)(ON=C(c1ccc(OCCCOc2ccc(/C(=N/OS(=O)(=O)C(F)(F)F)C(F)(F)F)cc2)cc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H14F12N2O8S2/c22-18(23,24)16(34-42-44(36,37)20(28,29)30)12-2-6-14(7-3-12)40-10-1-11-41-15-8-4-13(5-9-15)17(19(25,26)27)35-43-45(38,39)21(31,32)33/h2-9H,1,10-11H2/b34-16-,35-17? |
| InChIKey | SNIKGVKUNKWNFN-ODDVHHJYSA-N |
| XLogP | 5.80 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|