C9H4ClF6NO3S — CID 140525159
[(Z)-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trifluoromethanesulfonate (PubChem CID 140525159) has the molecular formula C9H4ClF6NO3S and a molecular weight of 355.64 g/mol. Its IUPAC name is [(Z)-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trifluoromethanesulfonate.
| Compound Name | [(Z)-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140525159 |
| Molecular Formula | C9H4ClF6NO3S |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | [(Z)-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O/N=C(/c1ccc(Cl)cc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4ClF6NO3S/c10-6-3-1-5(2-4-6)7(8(11,12)13)17-20-21(18,19)9(14,15)16/h1-4H/b17-7- |
| InChIKey | DXIRNERMSVQLFE-IDUWFGFVSA-N |
| XLogP | 3.47 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|