C16H13ClF3NO3S — CID 156769968
[[1-(3-chloro-4-methylphenyl)-2,2,2-trifluoroethylidene]amino] phenylmethanesulfonate (PubChem CID 156769968) has the molecular formula C16H13ClF3NO3S and a molecular weight of 391.80 g/mol. Its IUPAC name is [[1-(3-chloro-4-methylphenyl)-2,2,2-trifluoroethylidene]amino] phenylmethanesulfonate.
| Compound Name | [[1-(3-chloro-4-methylphenyl)-2,2,2-trifluoroethylidene]amino] phenylmethanesulfonate |
|---|---|
| PubChem CID | 156769968 |
| Molecular Formula | C16H13ClF3NO3S |
| Molecular Weight | 391.80 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | [[1-(3-chloro-4-methylphenyl)-2,2,2-trifluoroethylidene]amino] phenylmethanesulfonate |
| SMILES | Cc1ccc(C(=NOS(=O)(=O)Cc2ccccc2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H13ClF3NO3S/c1-11-7-8-13(9-14(11)17)15(16(18,19)20)21-24-25(22,23)10-12-5-3-2-4-6-12/h2-9H,10H2,1H3 |
| InChIKey | SNQYUMOJFFLKMV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|