C9H5Cl3F3NO3S — CID 87526373
[(2,2,2-trifluoro-1-phenylethylidene)amino] trichloromethanesulfonate (PubChem CID 87526373) has the molecular formula C9H5Cl3F3NO3S and a molecular weight of 370.56 g/mol. Its IUPAC name is [(2,2,2-trifluoro-1-phenylethylidene)amino] trichloromethanesulfonate.
| Compound Name | [(2,2,2-trifluoro-1-phenylethylidene)amino] trichloromethanesulfonate |
|---|---|
| PubChem CID | 87526373 |
| Molecular Formula | C9H5Cl3F3NO3S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | [(2,2,2-trifluoro-1-phenylethylidene)amino] trichloromethanesulfonate |
| SMILES | O=S(=O)(ON=C(c1ccccc1)C(F)(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H5Cl3F3NO3S/c10-9(11,12)20(17,18)19-16-7(8(13,14)15)6-4-2-1-3-5-6/h1-5H |
| InChIKey | BBCBLIKAZMOTQC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|