C10H10F3NO3S — CID 23557597
[(E)-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate (PubChem CID 23557597) has the molecular formula C10H10F3NO3S and a molecular weight of 281.26 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 23557597 |
| Molecular Formula | C10H10F3NO3S |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] methanesulfonate |
| SMILES | Cc1ccc(/C(=N\OS(C)(=O)=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO3S/c1-7-3-5-8(6-4-7)9(10(11,12)13)14-17-18(2,15)16/h3-6H,1-2H3/b14-9+ |
| InChIKey | HKTJEXSBIFCXSX-NTEUORMPSA-N |
| XLogP | 2.24 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|