C16H11F6NO3S — CID 10960591
[bis[4-(trifluoromethyl)phenyl]methylideneamino] methanesulfonate (PubChem CID 10960591) has the molecular formula C16H11F6NO3S and a molecular weight of 411.32 g/mol. Its IUPAC name is [bis[4-(trifluoromethyl)phenyl]methylideneamino] methanesulfonate.
| Compound Name | [bis[4-(trifluoromethyl)phenyl]methylideneamino] methanesulfonate |
|---|---|
| PubChem CID | 10960591 |
| Molecular Formula | C16H11F6NO3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [bis[4-(trifluoromethyl)phenyl]methylideneamino] methanesulfonate |
| SMILES | CS(=O)(=O)ON=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F6NO3S/c1-27(24,25)26-23-14(10-2-6-12(7-3-10)15(17,18)19)11-4-8-13(9-5-11)16(20,21)22/h2-9H,1H3 |
| InChIKey | IMHBVSBSXJYAHF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|