C18H15F2NO2S — CID 154719663
N-[(1E,4E)-1,5-bis(4-fluorophenyl)penta-1,4-dien-3-ylidene]methanesulfonamide (PubChem CID 154719663) has the molecular formula C18H15F2NO2S and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[(1E,4E)-1,5-bis(4-fluorophenyl)penta-1,4-dien-3-ylidene]methanesulfonamide.
| Compound Name | N-[(1E,4E)-1,5-bis(4-fluorophenyl)penta-1,4-dien-3-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 154719663 |
| Molecular Formula | C18H15F2NO2S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[(1E,4E)-1,5-bis(4-fluorophenyl)penta-1,4-dien-3-ylidene]methanesulfonamide |
| SMILES | CS(=O)(=O)N=C(/C=C/c1ccc(F)cc1)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15F2NO2S/c1-24(22,23)21-18(12-6-14-2-8-16(19)9-3-14)13-7-15-4-10-17(20)11-5-15/h2-13H,1H3/b12-6+,13-7+ |
| InChIKey | VLRSBRHJBMKCQC-PWHKKFIBSA-N |
| XLogP | 4.09 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|