C20H15F6NO2S — CID 154719682
N-[(1E,4E)-1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]methanesulfonamide (PubChem CID 154719682) has the molecular formula C20H15F6NO2S and a molecular weight of 447.40 g/mol. Its IUPAC name is N-[(1E,4E)-1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]methanesulfonamide.
| Compound Name | N-[(1E,4E)-1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 154719682 |
| Molecular Formula | C20H15F6NO2S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[(1E,4E)-1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]methanesulfonamide |
| SMILES | CS(=O)(=O)N=C(/C=C/c1ccc(C(F)(F)F)cc1)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F6NO2S/c1-30(28,29)27-18(12-6-14-2-8-16(9-3-14)19(21,22)23)13-7-15-4-10-17(11-5-15)20(24,25)26/h2-13H,1H3/b12-6+,13-7+ |
| InChIKey | JWPBOZUIWDIAPX-PWHKKFIBSA-N |
| XLogP | 5.85 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|