C12H14F3NOS — CID 11637674
(NE,R)-2-methyl-N-(2,2,2-trifluoro-1-phenylethylidene)propane-2-sulfinamide (PubChem CID 11637674) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-(2,2,2-trifluoro-1-phenylethylidene)propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-(2,2,2-trifluoro-1-phenylethylidene)propane-2-sulfinamide |
|---|---|
| PubChem CID | 11637674 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (NE,R)-2-methyl-N-(2,2,2-trifluoro-1-phenylethylidene)propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C(\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NOS/c1-11(2,3)18(17)16-10(12(13,14)15)9-7-5-4-6-8-9/h4-8H,1-3H3/b16-10+/t18-/m1/s1 |
| InChIKey | AWXLZIPEFCRBKW-GANRHZMWSA-N |
| XLogP | 3.50 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|