C17H9F10NO4S — CID 87091926
[[2,2,3,3,4,4,4-heptafluoro-1-(4-phenoxyphenyl)butylidene]amino] trifluoromethanesulfonate (PubChem CID 87091926) has the molecular formula C17H9F10NO4S and a molecular weight of 513.31 g/mol. Its IUPAC name is [[2,2,3,3,4,4,4-heptafluoro-1-(4-phenoxyphenyl)butylidene]amino] trifluoromethanesulfonate.
| Compound Name | [[2,2,3,3,4,4,4-heptafluoro-1-(4-phenoxyphenyl)butylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87091926 |
| Molecular Formula | C17H9F10NO4S |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | [[2,2,3,3,4,4,4-heptafluoro-1-(4-phenoxyphenyl)butylidene]amino] trifluoromethanesulfonate |
| SMILES | O=S(=O)(ON=C(c1ccc(Oc2ccccc2)cc1)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H9F10NO4S/c18-14(19,15(20,21)16(22,23)24)13(28-32-33(29,30)17(25,26)27)10-6-8-12(9-7-10)31-11-4-2-1-3-5-11/h1-9H |
| InChIKey | HXULNCPGKYBPOP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|