C30H25F10NO7S — CID 89062302
[3,3,4,4-tetrafluoro-4-[[2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethyl)phenoxy]propoxy]phenyl]ethylidene]amino]oxysulfonylbutyl] benzoate (PubChem CID 89062302) has the molecular formula C30H25F10NO7S and a molecular weight of 733.58 g/mol. Its IUPAC name is [3,3,4,4-tetrafluoro-4-[[2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethyl)phenoxy]propoxy]phenyl]ethylidene]amino]oxysulfonylbutyl] benzoate.
| Compound Name | [3,3,4,4-tetrafluoro-4-[[2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethyl)phenoxy]propoxy]phenyl]ethylidene]amino]oxysulfonylbutyl] benzoate |
|---|---|
| PubChem CID | 89062302 |
| Molecular Formula | C30H25F10NO7S |
| Molecular Weight | 733.58 g/mol |
| Exact Mass | 733.12 |
| IUPAC Name | [3,3,4,4-tetrafluoro-4-[[2,2,2-trifluoro-1-[4-[3-[4-(2,2,2-trifluoroethyl)phenoxy]propoxy]phenyl]ethylidene]amino]oxysulfonylbutyl] benzoate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)ON=C(c1ccc(OCCCOc2ccc(CC(F)(F)F)cc2)cc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C30H25F10NO7S/c31-27(32,15-18-47-26(42)22-5-2-1-3-6-22)30(39,40)49(43,44)48-41-25(29(36,37)38)21-9-13-24(14-10-21)46-17-4-16-45-23-11-7-20(8-12-23)19-28(33,34)35/h1-3,5-14H,4,15-19H2 |
| InChIKey | MOQSCKMTPVQXKH-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.58 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|