C13H9F9O2 — CID 87321833
3,3,4,4,5,5,6,6,6-nonafluorohexyl benzoate (PubChem CID 87321833) has the molecular formula C13H9F9O2 and a molecular weight of 368.20 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl benzoate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl benzoate |
|---|---|
| PubChem CID | 87321833 |
| Molecular Formula | C13H9F9O2 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl benzoate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H9F9O2/c14-10(15,11(16,17)12(18,19)13(20,21)22)6-7-24-9(23)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | CZFKXAUXVAWSHF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|