C36H28F26O4S2 — CID 177401041
6-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoyl]oxyhexyl 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoate (PubChem CID 177401041) has the molecular formula C36H28F26O4S2 and a molecular weight of 1082.70 g/mol. Its IUPAC name is 6-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoyl]oxyhexyl 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoate.
| Compound Name | 6-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoyl]oxyhexyl 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoate |
|---|---|
| PubChem CID | 177401041 |
| Molecular Formula | C36H28F26O4S2 |
| Molecular Weight | 1082.70 g/mol |
| Exact Mass | 1082.10 |
| IUPAC Name | 6-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoyl]oxyhexyl 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoate |
| SMILES | O=C(OCCCCCCOC(=O)c1ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H28F26O4S2/c37-25(38,27(41,42)29(45,46)31(49,50)33(53,54)35(57,58)59)13-17-67-21-9-5-19(6-10-21)23(63)65-15-3-1-2-4-16-66-24(64)20-7-11-22(12-8-20)68-18-14-26(39,40)28(43,44)30(47,48)32(51,52)34(55,56)36(60,61)62/h5-12H,1-4,13-18H2 |
| InChIKey | FKDVTHZKNSCWJJ-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.70 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|