C22H12F16O2S — CID 132502044
[4-(trifluoromethyl)phenyl] 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoate (PubChem CID 132502044) has the molecular formula C22H12F16O2S and a molecular weight of 644.37 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoate.
| Compound Name | [4-(trifluoromethyl)phenyl] 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoate |
|---|---|
| PubChem CID | 132502044 |
| Molecular Formula | C22H12F16O2S |
| Molecular Weight | 644.37 g/mol |
| Exact Mass | 644.03 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)benzoate |
| SMILES | O=C(Oc1ccc(C(F)(F)F)cc1)c1ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H12F16O2S/c23-16(24,18(28,29)19(30,31)20(32,33)21(34,35)22(36,37)38)9-10-41-14-7-1-11(2-8-14)15(39)40-13-5-3-12(4-6-13)17(25,26)27/h1-8H,9-10H2 |
| InChIKey | KLRMBFOTKAROBM-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.37 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|