C21H8F15NO2 — CID 71320861
(4-cyanophenyl) 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzoate (PubChem CID 71320861) has the molecular formula C21H8F15NO2 and a molecular weight of 591.27 g/mol. Its IUPAC name is (4-cyanophenyl) 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzoate.
| Compound Name | (4-cyanophenyl) 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzoate |
|---|---|
| PubChem CID | 71320861 |
| Molecular Formula | C21H8F15NO2 |
| Molecular Weight | 591.27 g/mol |
| Exact Mass | 591.03 |
| IUPAC Name | (4-cyanophenyl) 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzoate |
| SMILES | N#Cc1ccc(OC(=O)c2ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H8F15NO2/c22-15(23,12-5-3-11(4-6-12)14(38)39-13-7-1-10(9-37)2-8-13)16(24,25)17(26,27)18(28,29)19(30,31)20(32,33)21(34,35)36/h1-8H |
| InChIKey | FGHWXCHFYKPHFB-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.27 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|