C39H17F26NO4 — CID 101009620
[4-[[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzoyl]oxyphenyl]iminomethyl]phenyl] 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzoate (PubChem CID 101009620) has the molecular formula C39H17F26NO4 and a molecular weight of 1057.52 g/mol. Its IUPAC name is [4-[[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzoyl]oxyphenyl]iminomethyl]phenyl] 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzoate.
| Compound Name | [4-[[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzoyl]oxyphenyl]iminomethyl]phenyl] 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzoate |
|---|---|
| PubChem CID | 101009620 |
| Molecular Formula | C39H17F26NO4 |
| Molecular Weight | 1057.52 g/mol |
| Exact Mass | 1057.07 |
| IUPAC Name | [4-[[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzoyl]oxyphenyl]iminomethyl]phenyl] 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzoate |
| SMILES | O=C(Oc1ccc(/C=N/c2ccc(OC(=O)c3ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)cc1)c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H17F26NO4/c40-28(41,30(44,45)32(48,49)34(52,53)36(56,57)38(60,61)62)21-7-3-19(4-8-21)26(67)69-24-13-1-18(2-14-24)17-66-23-11-15-25(16-12-23)70-27(68)20-5-9-22(10-6-20)29(42,43)31(46,47)33(50,51)35(54,55)37(58,59)39(63,64)65/h1-17H/b66-17+ |
| InChIKey | IZCFMYNWKXZKOM-WNFICLPOSA-N |
| XLogP | 14.27 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.52 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|