C17H7F17O2S — CID 150615601
[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] 2-sulfanylprop-2-enoate (PubChem CID 150615601) has the molecular formula C17H7F17O2S and a molecular weight of 598.27 g/mol. Its IUPAC name is [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] 2-sulfanylprop-2-enoate.
| Compound Name | [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] 2-sulfanylprop-2-enoate |
|---|---|
| PubChem CID | 150615601 |
| Molecular Formula | C17H7F17O2S |
| Molecular Weight | 598.27 g/mol |
| Exact Mass | 597.99 |
| IUPAC Name | [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] 2-sulfanylprop-2-enoate |
| SMILES | C=C(S)C(=O)Oc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H7F17O2S/c1-6(37)9(35)36-8-4-2-7(3-5-8)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h2-5,37H,1H2 |
| InChIKey | IUUVKQBNNBDZHY-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.27 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|