C12H13FO3 — CID 129146398
[4-(2-hydroxypropan-2-yl)phenyl] 2-fluoroprop-2-enoate (PubChem CID 129146398) has the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. Its IUPAC name is [4-(2-hydroxypropan-2-yl)phenyl] 2-fluoroprop-2-enoate.
| Compound Name | [4-(2-hydroxypropan-2-yl)phenyl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 129146398 |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | [4-(2-hydroxypropan-2-yl)phenyl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)Oc1ccc(C(C)(C)O)cc1 |
| InChI | InChI=1S/C12H13FO3/c1-8(13)11(14)16-10-6-4-9(5-7-10)12(2,3)15/h4-7,15H,1H2,2-3H3 |
| InChIKey | PXJJRQGKKXUABD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|