C20H14F2O4 — CID 67472341
[7-(2-fluoroprop-2-enoyloxy)-9-methyl-9H-fluoren-2-yl] 2-fluoroprop-2-enoate (PubChem CID 67472341) has the molecular formula C20H14F2O4 and a molecular weight of 356.32 g/mol. Its IUPAC name is [7-(2-fluoroprop-2-enoyloxy)-9-methyl-9H-fluoren-2-yl] 2-fluoroprop-2-enoate.
| Compound Name | [7-(2-fluoroprop-2-enoyloxy)-9-methyl-9H-fluoren-2-yl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 67472341 |
| Molecular Formula | C20H14F2O4 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [7-(2-fluoroprop-2-enoyloxy)-9-methyl-9H-fluoren-2-yl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)Oc1ccc2c(c1)C(C)c1cc(OC(=O)C(=C)F)ccc1-2 |
| InChI | InChI=1S/C20H14F2O4/c1-10-17-8-13(25-19(23)11(2)21)4-6-15(17)16-7-5-14(9-18(10)16)26-20(24)12(3)22/h4-10H,2-3H2,1H3 |
| InChIKey | OYQRMZCSRPZDMU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|