C31H26O8 — CID 122419874
[7-(3,4-dimethoxybenzoyl)oxy-9-methyl-9H-fluoren-2-yl] 3-hydroxy-4-methoxybenzoate (PubChem CID 122419874) has the molecular formula C31H26O8 and a molecular weight of 526.54 g/mol. Its IUPAC name is [7-(3,4-dimethoxybenzoyl)oxy-9-methyl-9H-fluoren-2-yl] 3-hydroxy-4-methoxybenzoate.
| Compound Name | [7-(3,4-dimethoxybenzoyl)oxy-9-methyl-9H-fluoren-2-yl] 3-hydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 122419874 |
| Molecular Formula | C31H26O8 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | [7-(3,4-dimethoxybenzoyl)oxy-9-methyl-9H-fluoren-2-yl] 3-hydroxy-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3c(c2)C(C)c2cc(OC(=O)c4ccc(OC)c(OC)c4)ccc2-3)cc1O |
| InChI | InChI=1S/C31H26O8/c1-17-24-15-20(38-30(33)18-5-11-27(35-2)26(32)13-18)7-9-22(24)23-10-8-21(16-25(17)23)39-31(34)19-6-12-28(36-3)29(14-19)37-4/h5-17,32H,1-4H3 |
| InChIKey | GBGIZJTWCRGEIG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|