C17H14O6 — CID 732048
(3-oxo-1-benzofuran-6-yl) 3,4-dimethoxybenzoate (PubChem CID 732048) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is (3-oxo-1-benzofuran-6-yl) 3,4-dimethoxybenzoate.
| Compound Name | (3-oxo-1-benzofuran-6-yl) 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 732048 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (3-oxo-1-benzofuran-6-yl) 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3c(c2)OCC3=O)cc1OC |
| InChI | InChI=1S/C17H14O6/c1-20-14-6-3-10(7-16(14)21-2)17(19)23-11-4-5-12-13(18)9-22-15(12)8-11/h3-8H,9H2,1-2H3 |
| InChIKey | MAWVYSFHOWBPKU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|