C17H16O5 — CID 78829912
2,3-dihydro-1,4-benzodioxin-6-yl 3-methoxy-4-methylbenzoate (PubChem CID 78829912) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl 3-methoxy-4-methylbenzoate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl 3-methoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 78829912 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl 3-methoxy-4-methylbenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc3c(c2)OCCO3)ccc1C |
| InChI | InChI=1S/C17H16O5/c1-11-3-4-12(9-15(11)19-2)17(18)22-13-5-6-14-16(10-13)21-8-7-20-14/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | RLWDDZYGKUFGAQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|