amino 3-methoxy-4-methylbenzoate

C9H11NO3 — CID 175307316

IUPACamino 3-methoxy-4-methylbenzoate
SMILESCOc1cc(C(=O)ON)ccc1C
InChIInChI=1S/C9H11NO3/c1-6-3-4-7(9(11)13-10)5-8(6)12-2/h3-5H,10H2,1-2H3
InChIKeyILCYEIAVVZXYRD-UHFFFAOYSA-N
MW181.19 g/mol
LogP1.03
Rot. Bonds2

About amino 3-methoxy-4-methylbenzoate

amino 3-methoxy-4-methylbenzoate (PubChem CID 175307316) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is amino 3-methoxy-4-methylbenzoate.

Molecular Properties

Compound Nameamino 3-methoxy-4-methylbenzoate
PubChem CID175307316
Molecular FormulaC9H11NO3
Molecular Weight181.19 g/mol
Exact Mass181.07
IUPAC Nameamino 3-methoxy-4-methylbenzoate
SMILESCOc1cc(C(=O)ON)ccc1C
InChIInChI=1S/C9H11NO3/c1-6-3-4-7(9(11)13-10)5-8(6)12-2/h3-5H,10H2,1-2H3
InChIKeyILCYEIAVVZXYRD-UHFFFAOYSA-N
XLogP1.03
TPSA61.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.19
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 3-methoxy-4-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 3-methoxy-4-methylbenzoate?
The IUPAC name of amino 3-methoxy-4-methylbenzoate (CID 175307316) is amino 3-methoxy-4-methylbenzoate.
What is the SMILES notation for amino 3-methoxy-4-methylbenzoate?
The canonical SMILES for amino 3-methoxy-4-methylbenzoate is COc1cc(C(=O)ON)ccc1C.
What is the InChIKey of amino 3-methoxy-4-methylbenzoate?
The InChIKey is ILCYEIAVVZXYRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-6-3-4-7(9(11)13-10)5-8(6)12-2/h3-5H,10H2,1-2H3.
What are the key properties of amino 3-methoxy-4-methylbenzoate?
amino 3-methoxy-4-methylbenzoate has a molecular weight of 181.19 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 3-methoxy-4-methylbenzoate is sourced from PubChem (CID 175307316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).